C18H27ClN2O3S — CID 87894500
1-[2-[1-(3-chlorophenyl)sulfonyl-1-oxidopyrrolidin-1-ium-2-yl]ethyl]-4-methylpiperidine (PubChem CID 87894500) has the molecular formula C18H27ClN2O3S and a molecular weight of 386.95 g/mol. Its IUPAC name is 1-[2-[1-(3-chlorophenyl)sulfonyl-1-oxidopyrrolidin-1-ium-2-yl]ethyl]-4-methylpiperidine.
| Compound Name | 1-[2-[1-(3-chlorophenyl)sulfonyl-1-oxidopyrrolidin-1-ium-2-yl]ethyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 87894500 |
| Molecular Formula | C18H27ClN2O3S |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 1-[2-[1-(3-chlorophenyl)sulfonyl-1-oxidopyrrolidin-1-ium-2-yl]ethyl]-4-methylpiperidine |
| SMILES | CC1CCN(CCC2CCC[N+]2([O-])S(=O)(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H27ClN2O3S/c1-15-7-10-20(11-8-15)12-9-17-5-3-13-21(17,22)25(23,24)18-6-2-4-16(19)14-18/h2,4,6,14-15,17H,3,5,7-13H2,1H3 |
| InChIKey | ACXTYIJPIFXTLU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|