C3H6BF2O2- — CID 87894705
2,2-difluoro-1,3-dioxa-2-boranuidacyclohexane (PubChem CID 87894705) has the molecular formula C3H6BF2O2- and a molecular weight of 122.89 g/mol. Its IUPAC name is 2,2-difluoro-1,3-dioxa-2-boranuidacyclohexane.
| Compound Name | 2,2-difluoro-1,3-dioxa-2-boranuidacyclohexane |
|---|---|
| PubChem CID | 87894705 |
| Molecular Formula | C3H6BF2O2- |
| Molecular Weight | 122.89 g/mol |
| Exact Mass | 123.04 |
| IUPAC Name | 2,2-difluoro-1,3-dioxa-2-boranuidacyclohexane |
| SMILES | F[B-]1(F)OCCCO1 |
| InChI | InChI=1S/C3H6BF2O2/c5-4(6)7-2-1-3-8-4/h1-3H2/q-1 |
| InChIKey | MUOLESWTXIJVCM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.89 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|