C20H33LiN2O3 — CID 87898685
lithium;butane;tert-butyl 4-hydroxy-4-(3-methyl-2-pyridinyl)piperidine-1-carboxylate (PubChem CID 87898685) has the molecular formula C20H33LiN2O3 and a molecular weight of 356.44 g/mol. Its IUPAC name is lithium;butane;tert-butyl 4-hydroxy-4-(3-methyl-2-pyridinyl)piperidine-1-carboxylate.
| Compound Name | lithium;butane;tert-butyl 4-hydroxy-4-(3-methyl-2-pyridinyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87898685 |
| Molecular Formula | C20H33LiN2O3 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | lithium;butane;tert-butyl 4-hydroxy-4-(3-methyl-2-pyridinyl)piperidine-1-carboxylate |
| SMILES | Cc1cccnc1C1(O)CCN(C(=O)OC(C)(C)C)CC1.[CH2-]CCC.[Li+] |
| InChI | InChI=1S/C16H24N2O3.C4H9.Li/c1-12-6-5-9-17-13(12)16(20)7-10-18(11-8-16)14(19)21-15(2,3)4;1-3-4-2;/h5-6,9,20H,7-8,10-11H2,1-4H3;1,3-4H2,2H3;/q;-1;+1 |
| InChIKey | CYEMVUQJFKHJDU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|