C7H15NO2S4 — CID 87898694
3,3-bis(sulfanyl)propyl N-[3,3-bis(sulfanyl)propyl]carbamate (PubChem CID 87898694) has the molecular formula C7H15NO2S4 and a molecular weight of 273.47 g/mol. Its IUPAC name is 3,3-bis(sulfanyl)propyl N-[3,3-bis(sulfanyl)propyl]carbamate.
| Compound Name | 3,3-bis(sulfanyl)propyl N-[3,3-bis(sulfanyl)propyl]carbamate |
|---|---|
| PubChem CID | 87898694 |
| Molecular Formula | C7H15NO2S4 |
| Molecular Weight | 273.47 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 3,3-bis(sulfanyl)propyl N-[3,3-bis(sulfanyl)propyl]carbamate |
| SMILES | O=C(NCCC(S)S)OCCC(S)S |
| InChI | InChI=1S/C7H15NO2S4/c9-7(8-3-1-5(11)12)10-4-2-6(13)14/h5-6,11-14H,1-4H2,(H,8,9) |
| InChIKey | VPZVUWPPDBUMMH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.47 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|