C14H32O5Si2 — CID 87900234
2,3-dihydroxypropyl prop-2-enoate;dimethyl-propyl-trimethylsilyloxysilane (PubChem CID 87900234) has the molecular formula C14H32O5Si2 and a molecular weight of 336.58 g/mol. Its IUPAC name is 2,3-dihydroxypropyl prop-2-enoate;dimethyl-propyl-trimethylsilyloxysilane.
| Compound Name | 2,3-dihydroxypropyl prop-2-enoate;dimethyl-propyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 87900234 |
| Molecular Formula | C14H32O5Si2 |
| Molecular Weight | 336.58 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2,3-dihydroxypropyl prop-2-enoate;dimethyl-propyl-trimethylsilyloxysilane |
| SMILES | C=CC(=O)OCC(O)CO.CCC[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C8H22OSi2.C6H10O4/c1-7-8-11(5,6)9-10(2,3)4;1-2-6(9)10-4-5(8)3-7/h7-8H2,1-6H3;2,5,7-8H,1,3-4H2 |
| InChIKey | OFNSSJSYZVUSNF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.58 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|