C15H25NaO7S — CID 87902894
sodium 1-hexoxy-1-oxo-3-prop-1-enoxycarbonylpentane-3-sulfonate (PubChem CID 87902894) has the molecular formula C15H25NaO7S and a molecular weight of 372.42 g/mol. Its IUPAC name is sodium 1-hexoxy-1-oxo-3-prop-1-enoxycarbonylpentane-3-sulfonate.
| Compound Name | sodium 1-hexoxy-1-oxo-3-prop-1-enoxycarbonylpentane-3-sulfonate |
|---|---|
| PubChem CID | 87902894 |
| Molecular Formula | C15H25NaO7S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | sodium 1-hexoxy-1-oxo-3-prop-1-enoxycarbonylpentane-3-sulfonate |
| SMILES | CC=COC(=O)C(CC)(CC(=O)OCCCCCC)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C15H26O7S.Na/c1-4-7-8-9-11-21-13(16)12-15(6-3,23(18,19)20)14(17)22-10-5-2;/h5,10H,4,6-9,11-12H2,1-3H3,(H,18,19,20);/q;+1/p-1 |
| InChIKey | RQKYIIGKXNIZSJ-UHFFFAOYSA-M |
| XLogP | -0.73 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|