C24H38N2O4 — CID 87903396
tert-butyl N-[2-(3-oxooctanoylamino)-4-pentylphenyl]carbamate (PubChem CID 87903396) has the molecular formula C24H38N2O4 and a molecular weight of 418.58 g/mol. Its IUPAC name is tert-butyl N-[2-(3-oxooctanoylamino)-4-pentylphenyl]carbamate.
| Compound Name | tert-butyl N-[2-(3-oxooctanoylamino)-4-pentylphenyl]carbamate |
|---|---|
| PubChem CID | 87903396 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | tert-butyl N-[2-(3-oxooctanoylamino)-4-pentylphenyl]carbamate |
| SMILES | CCCCCC(=O)CC(=O)Nc1cc(CCCCC)ccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H38N2O4/c1-6-8-10-12-18-14-15-20(26-23(29)30-24(3,4)5)21(16-18)25-22(28)17-19(27)13-11-9-7-2/h14-16H,6-13,17H2,1-5H3,(H,25,28)(H,26,29) |
| InChIKey | OWXIJUGDHKEDNE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|