C8H18N2O8S2 — CID 87903429
[[(1R,2R)-4-ethyl-2-(sulfooxyamino)cyclohexyl]amino] hydrogen sulfate (PubChem CID 87903429) has the molecular formula C8H18N2O8S2 and a molecular weight of 334.37 g/mol. Its IUPAC name is [[(1R,2R)-4-ethyl-2-(sulfooxyamino)cyclohexyl]amino] hydrogen sulfate.
| Compound Name | [[(1R,2R)-4-ethyl-2-(sulfooxyamino)cyclohexyl]amino] hydrogen sulfate |
|---|---|
| PubChem CID | 87903429 |
| Molecular Formula | C8H18N2O8S2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | [[(1R,2R)-4-ethyl-2-(sulfooxyamino)cyclohexyl]amino] hydrogen sulfate |
| SMILES | CCC1CC[C@@H](NOS(=O)(=O)O)[C@H](NOS(=O)(=O)O)C1 |
| InChI | InChI=1S/C8H18N2O8S2/c1-2-6-3-4-7(9-17-19(11,12)13)8(5-6)10-18-20(14,15)16/h6-10H,2-5H2,1H3,(H,11,12,13)(H,14,15,16)/t6?,7-,8-/m1/s1 |
| InChIKey | BICMPEVOSCJUSW-SPDVFEMOSA-N |
| XLogP | -0.42 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|