C7H16N2O8S2 — CID 87903413
[[(1R,2R)-4-methyl-2-(sulfooxyamino)cyclohexyl]amino] hydrogen sulfate (PubChem CID 87903413) has the molecular formula C7H16N2O8S2 and a molecular weight of 320.35 g/mol. Its IUPAC name is [[(1R,2R)-4-methyl-2-(sulfooxyamino)cyclohexyl]amino] hydrogen sulfate.
| Compound Name | [[(1R,2R)-4-methyl-2-(sulfooxyamino)cyclohexyl]amino] hydrogen sulfate |
|---|---|
| PubChem CID | 87903413 |
| Molecular Formula | C7H16N2O8S2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | [[(1R,2R)-4-methyl-2-(sulfooxyamino)cyclohexyl]amino] hydrogen sulfate |
| SMILES | CC1CC[C@@H](NOS(=O)(=O)O)[C@H](NOS(=O)(=O)O)C1 |
| InChI | InChI=1S/C7H16N2O8S2/c1-5-2-3-6(8-16-18(10,11)12)7(4-5)9-17-19(13,14)15/h5-9H,2-4H2,1H3,(H,10,11,12)(H,13,14,15)/t5?,6-,7-/m1/s1 |
| InChIKey | WGLRULCAVRQRJN-JXBXZBNISA-N |
| XLogP | -0.81 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|