C24H18N2O5 — CID 87904579
6-(1,3-benzodioxol-5-yl)-1-(3-oxoprop-1-enyl)-6-phenyl-7H-indazole-3-carboxylic acid (PubChem CID 87904579) has the molecular formula C24H18N2O5 and a molecular weight of 414.42 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-1-(3-oxoprop-1-enyl)-6-phenyl-7H-indazole-3-carboxylic acid.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-1-(3-oxoprop-1-enyl)-6-phenyl-7H-indazole-3-carboxylic acid |
|---|---|
| PubChem CID | 87904579 |
| Molecular Formula | C24H18N2O5 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-1-(3-oxoprop-1-enyl)-6-phenyl-7H-indazole-3-carboxylic acid |
| SMILES | O=CC=Cn1nc(C(=O)O)c2c1CC(c1ccccc1)(c1ccc3c(c1)OCO3)C=C2 |
| InChI | InChI=1S/C24H18N2O5/c27-12-4-11-26-19-14-24(16-5-2-1-3-6-16,10-9-18(19)22(25-26)23(28)29)17-7-8-20-21(13-17)31-15-30-20/h1-13H,14-15H2,(H,28,29) |
| InChIKey | TXKBOVGGVSNGGF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|