C26H30BrNO4 — CID 87910278
(1S,9R,10R)-17-benzyl-3-hydroxy-4,12-dimethoxy-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one bromide (PubChem CID 87910278) has the molecular formula C26H30BrNO4 and a molecular weight of 500.43 g/mol. Its IUPAC name is (1S,9R,10R)-17-benzyl-3-hydroxy-4,12-dimethoxy-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one bromide.
| Compound Name | (1S,9R,10R)-17-benzyl-3-hydroxy-4,12-dimethoxy-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one bromide |
|---|---|
| PubChem CID | 87910278 |
| Molecular Formula | C26H30BrNO4 |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | (1S,9R,10R)-17-benzyl-3-hydroxy-4,12-dimethoxy-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one bromide |
| SMILES | COC1=C[C@H]2[C@H]3Cc4ccc(OC)c(O)c4[C@@]2(CC[N+]3(C)Cc2ccccc2)CC1=O.[Br-] |
| InChI | InChI=1S/C26H29NO4.BrH/c1-27(16-17-7-5-4-6-8-17)12-11-26-15-21(28)23(31-3)14-19(26)20(27)13-18-9-10-22(30-2)25(29)24(18)26;/h4-10,14,19-20H,11-13,15-16H2,1-3H3;1H/t19-,20+,26-,27?;/m0./s1 |
| InChIKey | JCQWVESIVCUBJH-WOLRTHOPSA-N |
| XLogP | 0.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|