C21H30BrNO4 — CID 10455901
(1R,9S,10R)-17-ethyl-13-hydroxy-4,12-dimethoxy-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-olate;hydrobromide (PubChem CID 10455901) has the molecular formula C21H30BrNO4 and a molecular weight of 440.38 g/mol. Its IUPAC name is (1R,9S,10R)-17-ethyl-13-hydroxy-4,12-dimethoxy-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-olate;hydrobromide.
| Compound Name | (1R,9S,10R)-17-ethyl-13-hydroxy-4,12-dimethoxy-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-olate;hydrobromide |
|---|---|
| PubChem CID | 10455901 |
| Molecular Formula | C21H30BrNO4 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | (1R,9S,10R)-17-ethyl-13-hydroxy-4,12-dimethoxy-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-3-olate;hydrobromide |
| SMILES | Br.CC[N+]1(C)CC[C@@]23CC(O)C(OC)=C[C@H]2[C@@H]1Cc1ccc(OC)c([O-])c13 |
| InChI | InChI=1S/C21H29NO4.BrH/c1-5-22(2)9-8-21-12-16(23)18(26-4)11-14(21)15(22)10-13-6-7-17(25-3)20(24)19(13)21;/h6-7,11,14-16,23H,5,8-10,12H2,1-4H3;1H/t14-,15-,16?,21+,22?;/m0./s1 |
| InChIKey | LEXMECPZYBMYLV-NLWRDSHBSA-N |
| XLogP | 2.29 |
| TPSA | 61.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|