C49H69BrN2O2 — CID 87910748
3-N,4-N-bis(3,4-dibutylphenyl)decane-3,4-diimine;4-bromo-5-methylnaphthalene-1,2-diol (PubChem CID 87910748) has the molecular formula C49H69BrN2O2 and a molecular weight of 798.01 g/mol. Its IUPAC name is 3-N,4-N-bis(3,4-dibutylphenyl)decane-3,4-diimine;4-bromo-5-methylnaphthalene-1,2-diol.
| Compound Name | 3-N,4-N-bis(3,4-dibutylphenyl)decane-3,4-diimine;4-bromo-5-methylnaphthalene-1,2-diol |
|---|---|
| PubChem CID | 87910748 |
| Molecular Formula | C49H69BrN2O2 |
| Molecular Weight | 798.01 g/mol |
| Exact Mass | 796.45 |
| IUPAC Name | 3-N,4-N-bis(3,4-dibutylphenyl)decane-3,4-diimine;4-bromo-5-methylnaphthalene-1,2-diol |
| SMILES | CCCCCCC(=N\c1ccc(CCCC)c(CCCC)c1)/C(CC)=N/c1ccc(CCCC)c(CCCC)c1.Cc1cccc2c(O)c(O)cc(Br)c12 |
| InChI | InChI=1S/C38H60N2.C11H9BrO2/c1-7-13-18-19-24-38(40-36-28-26-32(21-15-9-3)34(30-36)23-17-11-5)37(12-6)39-35-27-25-31(20-14-8-2)33(29-35)22-16-10-4;1-6-3-2-4-7-10(6)8(12)5-9(13)11(7)14/h25-30H,7-24H2,1-6H3;2-5,13-14H,1H3/b39-37+,40-38+; |
| InChIKey | HKTKVCLNKSGIRE-IJKDMPGWSA-N |
| XLogP | 15.60 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.01 |
| LogP ≤ 5 | 15.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|