C16H24N5O20P3 — CID 87912639
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 87912639) has the molecular formula C16H24N5O20P3 and a molecular weight of 699.30 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 87912639 |
| Molecular Formula | C16H24N5O20P3 |
| Molecular Weight | 699.30 g/mol |
| Exact Mass | 699.02 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H16N5O13P3.C6H8O7/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20;7-3(8)1-6(13,5(11)12)2-4(9)10/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t4-,6-,7-,10-;/m1./s1 |
| InChIKey | PCCGIDWCDYOXDK-MCDZGGTQSA-N |
| XLogP | -2.88 |
| TPSA | 411.26 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.30 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|