C12H10ClN3 — CID 87915196
5-[(1S,5S)-6-azabicyclo[3.2.0]hept-3-en-3-yl]-2-chloropyridine-3-carbonitrile (PubChem CID 87915196) has the molecular formula C12H10ClN3 and a molecular weight of 231.69 g/mol. Its IUPAC name is 5-[(1S,5S)-6-azabicyclo[3.2.0]hept-3-en-3-yl]-2-chloropyridine-3-carbonitrile.
| Compound Name | 5-[(1S,5S)-6-azabicyclo[3.2.0]hept-3-en-3-yl]-2-chloropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 87915196 |
| Molecular Formula | C12H10ClN3 |
| Molecular Weight | 231.69 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 5-[(1S,5S)-6-azabicyclo[3.2.0]hept-3-en-3-yl]-2-chloropyridine-3-carbonitrile |
| SMILES | N#Cc1cc(C2=C[C@@H]3NC[C@@H]3C2)cnc1Cl |
| InChI | InChI=1S/C12H10ClN3/c13-12-8(4-14)2-9(5-16-12)7-1-10-6-15-11(10)3-7/h2-3,5,10-11,15H,1,6H2/t10-,11-/m0/s1 |
| InChIKey | UNCUPCHZTQWNFV-QWRGUYRKSA-N |
| XLogP | 1.98 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.69 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|