C13H12ClN3 — CID 87915307
5-[(1R,6R)-7-azabicyclo[4.2.0]oct-4-en-4-yl]-2-chloropyridine-3-carbonitrile (PubChem CID 87915307) has the molecular formula C13H12ClN3 and a molecular weight of 245.71 g/mol. Its IUPAC name is 5-[(1R,6R)-7-azabicyclo[4.2.0]oct-4-en-4-yl]-2-chloropyridine-3-carbonitrile.
| Compound Name | 5-[(1R,6R)-7-azabicyclo[4.2.0]oct-4-en-4-yl]-2-chloropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 87915307 |
| Molecular Formula | C13H12ClN3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 5-[(1R,6R)-7-azabicyclo[4.2.0]oct-4-en-4-yl]-2-chloropyridine-3-carbonitrile |
| SMILES | N#Cc1cc(C2=C[C@H]3NC[C@H]3CC2)cnc1Cl |
| InChI | InChI=1S/C13H12ClN3/c14-13-10(5-15)3-11(7-17-13)8-1-2-9-6-16-12(9)4-8/h3-4,7,9,12,16H,1-2,6H2/t9-,12-/m1/s1 |
| InChIKey | AOLFNAZEQOJCSJ-BXKDBHETSA-N |
| XLogP | 2.37 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|