C32H40N2O5S — CID 87917240
(2R,3S)-N-[(1R)-6-[(2,6-dimethylpiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydroxy-4-sulfonylbutanamide;naphthalene (PubChem CID 87917240) has the molecular formula C32H40N2O5S and a molecular weight of 564.75 g/mol. Its IUPAC name is (2R,3S)-N-[(1R)-6-[(2,6-dimethylpiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydroxy-4-sulfonylbutanamide;naphthalene.
| Compound Name | (2R,3S)-N-[(1R)-6-[(2,6-dimethylpiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydroxy-4-sulfonylbutanamide;naphthalene |
|---|---|
| PubChem CID | 87917240 |
| Molecular Formula | C32H40N2O5S |
| Molecular Weight | 564.75 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | (2R,3S)-N-[(1R)-6-[(2,6-dimethylpiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydroxy-4-sulfonylbutanamide;naphthalene |
| SMILES | CC1CCCC(C)N1Cc1ccc2c(c1)CCC[C@H]2NC(=O)[C@H](O)[C@H](O)C=S(=O)=O.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H32N2O5S.C10H8/c1-14-5-3-6-15(2)24(14)12-16-9-10-18-17(11-16)7-4-8-19(18)23-22(27)21(26)20(25)13-30(28)29;1-2-6-10-8-4-3-7-9(10)5-1/h9-11,13-15,19-21,25-26H,3-8,12H2,1-2H3,(H,23,27);1-8H/t14?,15?,19-,20-,21-;/m1./s1 |
| InChIKey | ZTZMEFRANHZTHC-KTPHIOEYSA-N |
| XLogP | 4.19 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.75 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|