C33H40N2O5S — CID 87917173
(4R,5S)-2,2-dimethyl-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-5-(sulfonylmethyl)-1,3-dioxolane-4-carboxamide;naphthalene (PubChem CID 87917173) has the molecular formula C33H40N2O5S and a molecular weight of 576.76 g/mol. Its IUPAC name is (4R,5S)-2,2-dimethyl-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-5-(sulfonylmethyl)-1,3-dioxolane-4-carboxamide;naphthalene.
| Compound Name | (4R,5S)-2,2-dimethyl-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-5-(sulfonylmethyl)-1,3-dioxolane-4-carboxamide;naphthalene |
|---|---|
| PubChem CID | 87917173 |
| Molecular Formula | C33H40N2O5S |
| Molecular Weight | 576.76 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | (4R,5S)-2,2-dimethyl-N-[(1R)-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-5-(sulfonylmethyl)-1,3-dioxolane-4-carboxamide;naphthalene |
| SMILES | CC1(C)O[C@H](C=S(=O)=O)[C@H](C(=O)N[C@@H]2CCCc3cc(CN4CCCCC4)ccc32)O1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H32N2O5S.C10H8/c1-23(2)29-20(15-31(27)28)21(30-23)22(26)24-19-8-6-7-17-13-16(9-10-18(17)19)14-25-11-4-3-5-12-25;1-2-6-10-8-4-3-7-9(10)5-1/h9-10,13,15,19-21H,3-8,11-12,14H2,1-2H3,(H,24,26);1-8H/t19-,20-,21-;/m1./s1 |
| InChIKey | MUJVPIMZYGWBCZ-UOUVWZHNSA-N |
| XLogP | 5.21 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.76 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|