C21H23ClFN3O2 — CID 87920692
[(3R,6S)-4-[(2-amino-4-chlorophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-3,6-dimethylpiperazin-2-ylidene]methanone (PubChem CID 87920692) has the molecular formula C21H23ClFN3O2 and a molecular weight of 403.89 g/mol. Its IUPAC name is [(3R,6S)-4-[(2-amino-4-chlorophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-3,6-dimethylpiperazin-2-ylidene]methanone.
| Compound Name | [(3R,6S)-4-[(2-amino-4-chlorophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-3,6-dimethylpiperazin-2-ylidene]methanone |
|---|---|
| PubChem CID | 87920692 |
| Molecular Formula | C21H23ClFN3O2 |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [(3R,6S)-4-[(2-amino-4-chlorophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-3,6-dimethylpiperazin-2-ylidene]methanone |
| SMILES | C[C@@H]1C(=C=O)N(Cc2ccc(F)cc2)[C@@H](C)CN1COc1ccc(Cl)cc1N |
| InChI | InChI=1S/C21H23ClFN3O2/c1-14-10-25(13-28-21-8-5-17(22)9-19(21)24)15(2)20(12-27)26(14)11-16-3-6-18(23)7-4-16/h3-9,14-15H,10-11,13,24H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | BSJMZOAKARCAMM-LSDHHAIUSA-N |
| XLogP | 3.71 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|