C21H21F2N3O4 — CID 175255073
[(3S,6R)-4-[(5-fluoro-2-nitrophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-3,6-dimethylpiperazin-2-ylidene]methanone (PubChem CID 175255073) has the molecular formula C21H21F2N3O4 and a molecular weight of 417.41 g/mol. Its IUPAC name is [(3S,6R)-4-[(5-fluoro-2-nitrophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-3,6-dimethylpiperazin-2-ylidene]methanone.
| Compound Name | [(3S,6R)-4-[(5-fluoro-2-nitrophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-3,6-dimethylpiperazin-2-ylidene]methanone |
|---|---|
| PubChem CID | 175255073 |
| Molecular Formula | C21H21F2N3O4 |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | [(3S,6R)-4-[(5-fluoro-2-nitrophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-3,6-dimethylpiperazin-2-ylidene]methanone |
| SMILES | C[C@@H]1CN(COc2cc(F)ccc2[N+](=O)[O-])[C@@H](C)C(=C=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H21F2N3O4/c1-14-10-24(13-30-21-9-18(23)7-8-19(21)26(28)29)15(2)20(12-27)25(14)11-16-3-5-17(22)6-4-16/h3-9,14-15H,10-11,13H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | RXYJBODIQBHGII-CABCVRRESA-N |
| XLogP | 3.52 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|