C16H21NO5S2 — CID 87926065
1-(4-ethoxyphenyl)-3,3-bis(2-hydroxyethylsulfanyl)pyrrolidine-2,5-dione (PubChem CID 87926065) has the molecular formula C16H21NO5S2 and a molecular weight of 371.48 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3,3-bis(2-hydroxyethylsulfanyl)pyrrolidine-2,5-dione.
| Compound Name | 1-(4-ethoxyphenyl)-3,3-bis(2-hydroxyethylsulfanyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 87926065 |
| Molecular Formula | C16H21NO5S2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3,3-bis(2-hydroxyethylsulfanyl)pyrrolidine-2,5-dione |
| SMILES | CCOc1ccc(N2C(=O)CC(SCCO)(SCCO)C2=O)cc1 |
| InChI | InChI=1S/C16H21NO5S2/c1-2-22-13-5-3-12(4-6-13)17-14(20)11-16(15(17)21,23-9-7-18)24-10-8-19/h3-6,18-19H,2,7-11H2,1H3 |
| InChIKey | LWKSDYIXVPFFSW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|