C22H27NO3 — CID 23736504
9-ethenyl-2-(4-ethoxyphenyl)-7-methyl-8-propan-2-ylidene-2-azaspiro[4.4]nonane-1,3-dione (PubChem CID 23736504) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is 9-ethenyl-2-(4-ethoxyphenyl)-7-methyl-8-propan-2-ylidene-2-azaspiro[4.4]nonane-1,3-dione.
| Compound Name | 9-ethenyl-2-(4-ethoxyphenyl)-7-methyl-8-propan-2-ylidene-2-azaspiro[4.4]nonane-1,3-dione |
|---|---|
| PubChem CID | 23736504 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 9-ethenyl-2-(4-ethoxyphenyl)-7-methyl-8-propan-2-ylidene-2-azaspiro[4.4]nonane-1,3-dione |
| SMILES | C=CC1C(=C(C)C)C(C)CC12CC(=O)N(c1ccc(OCC)cc1)C2=O |
| InChI | InChI=1S/C22H27NO3/c1-6-18-20(14(3)4)15(5)12-22(18)13-19(24)23(21(22)25)16-8-10-17(11-9-16)26-7-2/h6,8-11,15,18H,1,7,12-13H2,2-5H3 |
| InChIKey | RUXKDPQWZZLURE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|