C11H19N3O4S — CID 87927807
2-methylpropyl N-[1-(cyanomethylamino)-3-methylsulfinyl-1-oxopropan-2-yl]carbamate (PubChem CID 87927807) has the molecular formula C11H19N3O4S and a molecular weight of 289.36 g/mol. Its IUPAC name is 2-methylpropyl N-[1-(cyanomethylamino)-3-methylsulfinyl-1-oxopropan-2-yl]carbamate.
| Compound Name | 2-methylpropyl N-[1-(cyanomethylamino)-3-methylsulfinyl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 87927807 |
| Molecular Formula | C11H19N3O4S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-methylpropyl N-[1-(cyanomethylamino)-3-methylsulfinyl-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)COC(=O)NC(CS(C)=O)C(=O)NCC#N |
| InChI | InChI=1S/C11H19N3O4S/c1-8(2)6-18-11(16)14-9(7-19(3)17)10(15)13-5-4-12/h8-9H,5-7H2,1-3H3,(H,13,15)(H,14,16) |
| InChIKey | VFMSEJHAHUCOLB-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|