C13H25N3O5 — CID 4223405
2-methylpropyl N-[4-amino-1-(3-methoxypropylamino)-1,4-dioxobutan-2-yl]carbamate (PubChem CID 4223405) has the molecular formula C13H25N3O5 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-methylpropyl N-[4-amino-1-(3-methoxypropylamino)-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | 2-methylpropyl N-[4-amino-1-(3-methoxypropylamino)-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 4223405 |
| Molecular Formula | C13H25N3O5 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2-methylpropyl N-[4-amino-1-(3-methoxypropylamino)-1,4-dioxobutan-2-yl]carbamate |
| SMILES | COCCCNC(=O)C(CC(N)=O)NC(=O)OCC(C)C |
| InChI | InChI=1S/C13H25N3O5/c1-9(2)8-21-13(19)16-10(7-11(14)17)12(18)15-5-4-6-20-3/h9-10H,4-8H2,1-3H3,(H2,14,17)(H,15,18)(H,16,19) |
| InChIKey | LNEXBKWEZZMVJU-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|