C19H16AsCl2N4O4 — CID 87929262
CID 87929262 (PubChem CID 87929262) has the molecular formula C19H16AsCl2N4O4 and a molecular weight of 510.19 g/mol.
| Compound Name | CID 87929262 |
|---|---|
| PubChem CID | 87929262 |
| Molecular Formula | C19H16AsCl2N4O4 |
| Molecular Weight | 510.19 g/mol |
| Exact Mass | 508.98 |
| IUPAC Name | — |
| SMILES | Nc1nc([As]CCCc2[nH]cc(-c3ccc(Cl)cc3Cl)c2C(=O)O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16AsCl2N4O4/c21-10-3-4-11(13(22)8-10)12-9-24-14(17(12)19(27)28)2-1-7-20-16-6-5-15(26(29)30)18(23)25-16/h3-6,8-9,24H,1-2,7H2,(H2,23,25)(H,27,28) |
| InChIKey | DHWAZYCVFYQOSB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 135.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.19 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|