C28H30Cl2F3N9O4 — CID 123447063
N-[3-(6-amino-5-nitro-2-pyridinyl)propyl]-6-(2,4-dichlorophenyl)-2-[(4-methylpiperazin-1-yl)methyl]pyrazolo[1,5-a]pyrazin-4-amine;2,2,2-trifluoroacetic acid (PubChem CID 123447063) has the molecular formula C28H30Cl2F3N9O4 and a molecular weight of 684.51 g/mol. Its IUPAC name is N-[3-(6-amino-5-nitro-2-pyridinyl)propyl]-6-(2,4-dichlorophenyl)-2-[(4-methylpiperazin-1-yl)methyl]pyrazolo[1,5-a]pyrazin-4-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[3-(6-amino-5-nitro-2-pyridinyl)propyl]-6-(2,4-dichlorophenyl)-2-[(4-methylpiperazin-1-yl)methyl]pyrazolo[1,5-a]pyrazin-4-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 123447063 |
| Molecular Formula | C28H30Cl2F3N9O4 |
| Molecular Weight | 684.51 g/mol |
| Exact Mass | 683.17 |
| IUPAC Name | N-[3-(6-amino-5-nitro-2-pyridinyl)propyl]-6-(2,4-dichlorophenyl)-2-[(4-methylpiperazin-1-yl)methyl]pyrazolo[1,5-a]pyrazin-4-amine;2,2,2-trifluoroacetic acid |
| SMILES | CN1CCN(Cc2cc3c(NCCCc4ccc([N+](=O)[O-])c(N)n4)nc(-c4ccc(Cl)cc4Cl)cn3n2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H29Cl2N9O2.C2HF3O2/c1-34-9-11-35(12-10-34)15-19-14-24-26(30-8-2-3-18-5-7-23(37(38)39)25(29)31-18)32-22(16-36(24)33-19)20-6-4-17(27)13-21(20)28;3-2(4,5)1(6)7/h4-7,13-14,16H,2-3,8-12,15H2,1H3,(H2,29,31)(H,30,32);(H,6,7) |
| InChIKey | CFACBNDZPOEGHC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 168.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|