C11H13F3O4S2 — CID 87930370
3-phenoxy-1,1-bis(sulfanyl)propan-1-ol;2,2,2-trifluoroacetic acid (PubChem CID 87930370) has the molecular formula C11H13F3O4S2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 3-phenoxy-1,1-bis(sulfanyl)propan-1-ol;2,2,2-trifluoroacetic acid.
| Compound Name | 3-phenoxy-1,1-bis(sulfanyl)propan-1-ol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87930370 |
| Molecular Formula | C11H13F3O4S2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 3-phenoxy-1,1-bis(sulfanyl)propan-1-ol;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.OC(S)(S)CCOc1ccccc1 |
| InChI | InChI=1S/C9H12O2S2.C2HF3O2/c10-9(12,13)6-7-11-8-4-2-1-3-5-8;3-2(4,5)1(6)7/h1-5,10,12-13H,6-7H2;(H,6,7) |
| InChIKey | LLTGKQHWSRZZLQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|