C18H34O4 — CID 87932663
4,7-bis(tert-butylperoxy)-7-methylnon-2-yne (PubChem CID 87932663) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is 4,7-bis(tert-butylperoxy)-7-methylnon-2-yne.
| Compound Name | 4,7-bis(tert-butylperoxy)-7-methylnon-2-yne |
|---|---|
| PubChem CID | 87932663 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | 4,7-bis(tert-butylperoxy)-7-methylnon-2-yne |
| SMILES | CC#CC(CCC(C)(CC)OOC(C)(C)C)OOC(C)(C)C |
| InChI | InChI=1S/C18H34O4/c1-10-12-15(19-20-16(3,4)5)13-14-18(9,11-2)22-21-17(6,7)8/h15H,11,13-14H2,1-9H3 |
| InChIKey | LZYJPRUPVJSSKK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|