C15H32O4 — CID 22184035
1,1-bis(tert-butylperoxy)-2-methylhexane (PubChem CID 22184035) has the molecular formula C15H32O4 and a molecular weight of 276.42 g/mol. Its IUPAC name is 1,1-bis(tert-butylperoxy)-2-methylhexane.
| Compound Name | 1,1-bis(tert-butylperoxy)-2-methylhexane |
|---|---|
| PubChem CID | 22184035 |
| Molecular Formula | C15H32O4 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 1,1-bis(tert-butylperoxy)-2-methylhexane |
| SMILES | CCCCC(C)C(OOC(C)(C)C)OOC(C)(C)C |
| InChI | InChI=1S/C15H32O4/c1-9-10-11-12(2)13(16-18-14(3,4)5)17-19-15(6,7)8/h12-13H,9-11H2,1-8H3 |
| InChIKey | UECPTJGFMAOGFC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|