C17H35NO6 — CID 18608353
(2S)-2-(butylamino)-4,4-bis(tert-butylperoxy)-3-methylbutanoic acid (PubChem CID 18608353) has the molecular formula C17H35NO6 and a molecular weight of 349.47 g/mol. Its IUPAC name is (2S)-2-(butylamino)-4,4-bis(tert-butylperoxy)-3-methylbutanoic acid.
| Compound Name | (2S)-2-(butylamino)-4,4-bis(tert-butylperoxy)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18608353 |
| Molecular Formula | C17H35NO6 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | (2S)-2-(butylamino)-4,4-bis(tert-butylperoxy)-3-methylbutanoic acid |
| SMILES | CCCCN[C@H](C(=O)O)C(C)C(OOC(C)(C)C)OOC(C)(C)C |
| InChI | InChI=1S/C17H35NO6/c1-9-10-11-18-13(14(19)20)12(2)15(21-23-16(3,4)5)22-24-17(6,7)8/h12-13,15,18H,9-11H2,1-8H3,(H,19,20)/t12?,13-/m0/s1 |
| InChIKey | CIRUFRUBEFJSQK-ABLWVSNPSA-N |
| XLogP | 3.28 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|