C21H18F20O2 — CID 87940760
(2-cyclohexyl-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecan-2-yl) 2-(trifluoromethyl)prop-2-enoate (PubChem CID 87940760) has the molecular formula C21H18F20O2 and a molecular weight of 682.33 g/mol. Its IUPAC name is (2-cyclohexyl-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecan-2-yl) 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | (2-cyclohexyl-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecan-2-yl) 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 87940760 |
| Molecular Formula | C21H18F20O2 |
| Molecular Weight | 682.33 g/mol |
| Exact Mass | 682.10 |
| IUPAC Name | (2-cyclohexyl-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecan-2-yl) 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC(C)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C21H18F20O2/c1-9(14(24,25)26)11(42)43-12(2,10-6-4-3-5-7-10)8-13(22,23)15(27,28)16(29,30)17(31,32)18(33,34)19(35,36)20(37,38)21(39,40)41/h10H,1,3-8H2,2H3 |
| InChIKey | DAPQVOQBPWIFPL-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.33 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|