C13H21N2O+ — CID 8794414
[(2R)-1-amino-1-oxopropan-2-yl]-[(4-ethylphenyl)methyl]-methylazanium (PubChem CID 8794414) has the molecular formula C13H21N2O+ and a molecular weight of 221.32 g/mol. Its IUPAC name is [(2R)-1-amino-1-oxopropan-2-yl]-[(4-ethylphenyl)methyl]-methylazanium.
| Compound Name | [(2R)-1-amino-1-oxopropan-2-yl]-[(4-ethylphenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8794414 |
| Molecular Formula | C13H21N2O+ |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | [(2R)-1-amino-1-oxopropan-2-yl]-[(4-ethylphenyl)methyl]-methylazanium |
| SMILES | CCc1ccc(C[NH+](C)[C@H](C)C(N)=O)cc1 |
| InChI | InChI=1S/C13H20N2O/c1-4-11-5-7-12(8-6-11)9-15(3)10(2)13(14)16/h5-8,10H,4,9H2,1-3H3,(H2,14,16)/p+1/t10-/m1/s1 |
| InChIKey | VYCUUHMEOSFZRA-SNVBAGLBSA-O |
| XLogP | 0.14 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |