C12H15NO4S2 — CID 87945288
[(E)-[6-(hydroxymethyl)-2-methyl-2,3-dihydrothiochromen-4-ylidene]amino] methanesulfonate (PubChem CID 87945288) has the molecular formula C12H15NO4S2 and a molecular weight of 301.39 g/mol. Its IUPAC name is [(E)-[6-(hydroxymethyl)-2-methyl-2,3-dihydrothiochromen-4-ylidene]amino] methanesulfonate.
| Compound Name | [(E)-[6-(hydroxymethyl)-2-methyl-2,3-dihydrothiochromen-4-ylidene]amino] methanesulfonate |
|---|---|
| PubChem CID | 87945288 |
| Molecular Formula | C12H15NO4S2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | [(E)-[6-(hydroxymethyl)-2-methyl-2,3-dihydrothiochromen-4-ylidene]amino] methanesulfonate |
| SMILES | CC1C/C(=N\OS(C)(=O)=O)c2cc(CO)ccc2S1 |
| InChI | InChI=1S/C12H15NO4S2/c1-8-5-11(13-17-19(2,15)16)10-6-9(7-14)3-4-12(10)18-8/h3-4,6,8,14H,5,7H2,1-2H3/b13-11+ |
| InChIKey | AZZGUBZRKMKANK-ACCUITESSA-N |
| XLogP | 1.74 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|