C21H27NO11S — CID 87947062
2-hydroxypropane-1,2,3-tricarboxylic acid;[2-prop-2-ynoxy-4-(pyrrolidin-1-ylmethyl)phenyl] methanesulfonate (PubChem CID 87947062) has the molecular formula C21H27NO11S and a molecular weight of 501.51 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;[2-prop-2-ynoxy-4-(pyrrolidin-1-ylmethyl)phenyl] methanesulfonate.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;[2-prop-2-ynoxy-4-(pyrrolidin-1-ylmethyl)phenyl] methanesulfonate |
|---|---|
| PubChem CID | 87947062 |
| Molecular Formula | C21H27NO11S |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;[2-prop-2-ynoxy-4-(pyrrolidin-1-ylmethyl)phenyl] methanesulfonate |
| SMILES | C#CCOc1cc(CN2CCCC2)ccc1OS(C)(=O)=O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H19NO4S.C6H8O7/c1-3-10-19-15-11-13(12-16-8-4-5-9-16)6-7-14(15)20-21(2,17)18;7-3(8)1-6(13,5(11)12)2-4(9)10/h1,6-7,11H,4-5,8-10,12H2,2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | YPEXTACGTPUNHU-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 187.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|