C26H29Br2N5O2S — CID 87953383
N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-4-[2-[1-(2,3-dibromopropyl)-2H-pyridin-4-yl]-1,3-thiazol-4-yl]benzamide (PubChem CID 87953383) has the molecular formula C26H29Br2N5O2S and a molecular weight of 635.43 g/mol. Its IUPAC name is N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-4-[2-[1-(2,3-dibromopropyl)-2H-pyridin-4-yl]-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-4-[2-[1-(2,3-dibromopropyl)-2H-pyridin-4-yl]-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 87953383 |
| Molecular Formula | C26H29Br2N5O2S |
| Molecular Weight | 635.43 g/mol |
| Exact Mass | 633.04 |
| IUPAC Name | N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-4-[2-[1-(2,3-dibromopropyl)-2H-pyridin-4-yl]-1,3-thiazol-4-yl]benzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(-c2csc(C3=CCN(CC(Br)CBr)C=C3)n2)cc1)C(=O)NCC#N |
| InChI | InChI=1S/C26H29Br2N5O2S/c1-17(2)13-22(25(35)30-10-9-29)31-24(34)19-5-3-18(4-6-19)23-16-36-26(32-23)20-7-11-33(12-8-20)15-21(28)14-27/h3-8,11,16-17,21-22H,10,12-15H2,1-2H3,(H,30,35)(H,31,34)/t21?,22-/m0/s1 |
| InChIKey | HHRFRJVKUXEFPQ-KEKNWZKVSA-N |
| XLogP | 4.97 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|