C21H30BrN3O3 — CID 87956170
5-bromo-3-hexoxy-6-(2-methoxy-4-propan-2-yloxyphenyl)-N-methylpyrazin-2-amine (PubChem CID 87956170) has the molecular formula C21H30BrN3O3 and a molecular weight of 452.39 g/mol. Its IUPAC name is 5-bromo-3-hexoxy-6-(2-methoxy-4-propan-2-yloxyphenyl)-N-methylpyrazin-2-amine.
| Compound Name | 5-bromo-3-hexoxy-6-(2-methoxy-4-propan-2-yloxyphenyl)-N-methylpyrazin-2-amine |
|---|---|
| PubChem CID | 87956170 |
| Molecular Formula | C21H30BrN3O3 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 5-bromo-3-hexoxy-6-(2-methoxy-4-propan-2-yloxyphenyl)-N-methylpyrazin-2-amine |
| SMILES | CCCCCCOc1nc(Br)c(-c2ccc(OC(C)C)cc2OC)nc1NC |
| InChI | InChI=1S/C21H30BrN3O3/c1-6-7-8-9-12-27-21-20(23-4)24-18(19(22)25-21)16-11-10-15(28-14(2)3)13-17(16)26-5/h10-11,13-14H,6-9,12H2,1-5H3,(H,23,24) |
| InChIKey | FSQHOGFTXYSVTE-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|