C26H24ClN5O3S — CID 87958042
3-chloro-N-[1,3-dioxo-2-[2-(4-pyridin-4-ylpiperazin-1-yl)ethyl]isoindol-4-yl]-6-sulfanylidenecyclohexa-1,3-diene-1-carboxamide (PubChem CID 87958042) has the molecular formula C26H24ClN5O3S and a molecular weight of 522.03 g/mol. Its IUPAC name is 3-chloro-N-[1,3-dioxo-2-[2-(4-pyridin-4-ylpiperazin-1-yl)ethyl]isoindol-4-yl]-6-sulfanylidenecyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 3-chloro-N-[1,3-dioxo-2-[2-(4-pyridin-4-ylpiperazin-1-yl)ethyl]isoindol-4-yl]-6-sulfanylidenecyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 87958042 |
| Molecular Formula | C26H24ClN5O3S |
| Molecular Weight | 522.03 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 3-chloro-N-[1,3-dioxo-2-[2-(4-pyridin-4-ylpiperazin-1-yl)ethyl]isoindol-4-yl]-6-sulfanylidenecyclohexa-1,3-diene-1-carboxamide |
| SMILES | O=C(Nc1cccc2c1C(=O)N(CCN1CCN(c3ccncc3)CC1)C2=O)C1=CC(Cl)=CCC1=S |
| InChI | InChI=1S/C26H24ClN5O3S/c27-17-4-5-22(36)20(16-17)24(33)29-21-3-1-2-19-23(21)26(35)32(25(19)34)15-12-30-10-13-31(14-11-30)18-6-8-28-9-7-18/h1-4,6-9,16H,5,10-15H2,(H,29,33) |
| InChIKey | ICQROIOPANOJPT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.03 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|