C15H11ClN2O3S — CID 87893347
3-chloro-N-(3-hydroxy-1-oxo-2,3-dihydroisoindol-4-yl)-6-sulfanylidenecyclohexa-1,3-diene-1-carboxamide (PubChem CID 87893347) has the molecular formula C15H11ClN2O3S and a molecular weight of 334.78 g/mol. Its IUPAC name is 3-chloro-N-(3-hydroxy-1-oxo-2,3-dihydroisoindol-4-yl)-6-sulfanylidenecyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 3-chloro-N-(3-hydroxy-1-oxo-2,3-dihydroisoindol-4-yl)-6-sulfanylidenecyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 87893347 |
| Molecular Formula | C15H11ClN2O3S |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 3-chloro-N-(3-hydroxy-1-oxo-2,3-dihydroisoindol-4-yl)-6-sulfanylidenecyclohexa-1,3-diene-1-carboxamide |
| SMILES | O=C(Nc1cccc2c1C(O)NC2=O)C1=CC(Cl)=CCC1=S |
| InChI | InChI=1S/C15H11ClN2O3S/c16-7-4-5-11(22)9(6-7)14(20)17-10-3-1-2-8-12(10)15(21)18-13(8)19/h1-4,6,15,21H,5H2,(H,17,20)(H,18,19) |
| InChIKey | MSHUNLXHBHJPAJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|