C24H21ClN4O3S — CID 87890547
N-[2-[[3-[(carbamoylamino)methyl]phenyl]methyl]-3-oxo-1H-isoindol-4-yl]-3-chloro-6-sulfanylidenecyclohexa-1,3-diene-1-carboxamide (PubChem CID 87890547) has the molecular formula C24H21ClN4O3S and a molecular weight of 480.98 g/mol. Its IUPAC name is N-[2-[[3-[(carbamoylamino)methyl]phenyl]methyl]-3-oxo-1H-isoindol-4-yl]-3-chloro-6-sulfanylidenecyclohexa-1,3-diene-1-carboxamide.
| Compound Name | N-[2-[[3-[(carbamoylamino)methyl]phenyl]methyl]-3-oxo-1H-isoindol-4-yl]-3-chloro-6-sulfanylidenecyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 87890547 |
| Molecular Formula | C24H21ClN4O3S |
| Molecular Weight | 480.98 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | N-[2-[[3-[(carbamoylamino)methyl]phenyl]methyl]-3-oxo-1H-isoindol-4-yl]-3-chloro-6-sulfanylidenecyclohexa-1,3-diene-1-carboxamide |
| SMILES | NC(=O)NCc1cccc(CN2Cc3cccc(NC(=O)C4=CC(Cl)=CCC4=S)c3C2=O)c1 |
| InChI | InChI=1S/C24H21ClN4O3S/c25-17-7-8-20(33)18(10-17)22(30)28-19-6-2-5-16-13-29(23(31)21(16)19)12-15-4-1-3-14(9-15)11-27-24(26)32/h1-7,9-10H,8,11-13H2,(H,28,30)(H3,26,27,32) |
| InChIKey | LNZDNQOJKPNBIA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.98 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|