C42H64N2O8 — CID 87960203
5-[3-[2-butyl-3-(diazomethylidene)-1-(3,5-dibutylphenyl)hept-1-enyl]-5-(2,3,4,5-tetrahydroxypentyl)phenyl]pentane-1,2,3,4-tetrol (PubChem CID 87960203) has the molecular formula C42H64N2O8 and a molecular weight of 724.98 g/mol. Its IUPAC name is 5-[3-[2-butyl-3-(diazomethylidene)-1-(3,5-dibutylphenyl)hept-1-enyl]-5-(2,3,4,5-tetrahydroxypentyl)phenyl]pentane-1,2,3,4-tetrol.
| Compound Name | 5-[3-[2-butyl-3-(diazomethylidene)-1-(3,5-dibutylphenyl)hept-1-enyl]-5-(2,3,4,5-tetrahydroxypentyl)phenyl]pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 87960203 |
| Molecular Formula | C42H64N2O8 |
| Molecular Weight | 724.98 g/mol |
| Exact Mass | 724.47 |
| IUPAC Name | 5-[3-[2-butyl-3-(diazomethylidene)-1-(3,5-dibutylphenyl)hept-1-enyl]-5-(2,3,4,5-tetrahydroxypentyl)phenyl]pentane-1,2,3,4-tetrol |
| SMILES | CCCCC(=C=[N+]=[N-])C(CCCC)=C(c1cc(CCCC)cc(CCCC)c1)c1cc(CC(O)C(O)C(O)CO)cc(CC(O)C(O)C(O)CO)c1 |
| InChI | InChI=1S/C42H64N2O8/c1-5-9-13-28-17-29(14-10-6-2)20-33(19-28)40(35(16-12-8-4)32(25-44-43)15-11-7-3)34-21-30(23-36(47)41(51)38(49)26-45)18-31(22-34)24-37(48)42(52)39(50)27-46/h17-22,36-39,41-42,45-52H,5-16,23-24,26-27H2,1-4H3 |
| InChIKey | GXJFGPJTGIEHMU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 198.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.98 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|