C29H41FN6O5P2 — CID 87963383
4-[bis(ethylamino)phosphoryl-[[(4S,5S)-4,5-dimethyl-2-oxo-1,3,2λ5-diazaphospholidin-2-yl]oxy]methyl]-2-fluoro-N-methyl-N-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethyl]benzamide (PubChem CID 87963383) has the molecular formula C29H41FN6O5P2 and a molecular weight of 634.63 g/mol. Its IUPAC name is 4-[bis(ethylamino)phosphoryl-[[(4S,5S)-4,5-dimethyl-2-oxo-1,3,2λ5-diazaphospholidin-2-yl]oxy]methyl]-2-fluoro-N-methyl-N-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethyl]benzamide.
| Compound Name | 4-[bis(ethylamino)phosphoryl-[[(4S,5S)-4,5-dimethyl-2-oxo-1,3,2λ5-diazaphospholidin-2-yl]oxy]methyl]-2-fluoro-N-methyl-N-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 87963383 |
| Molecular Formula | C29H41FN6O5P2 |
| Molecular Weight | 634.63 g/mol |
| Exact Mass | 634.26 |
| IUPAC Name | 4-[bis(ethylamino)phosphoryl-[[(4S,5S)-4,5-dimethyl-2-oxo-1,3,2λ5-diazaphospholidin-2-yl]oxy]methyl]-2-fluoro-N-methyl-N-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethyl]benzamide |
| SMILES | CCNP(=O)(NCC)C(OP1(=O)N[C@@H](C)[C@H](C)N1)c1ccc(C(=O)N(C)CCc2nc(-c3ccccc3)oc2C)c(F)c1 |
| InChI | InChI=1S/C29H41FN6O5P2/c1-7-31-42(38,32-8-2)29(41-43(39)34-19(3)20(4)35-43)23-14-15-24(25(30)18-23)28(37)36(6)17-16-26-21(5)40-27(33-26)22-12-10-9-11-13-22/h9-15,18-20,29H,7-8,16-17H2,1-6H3,(H2,31,32,38)(H2,34,35,39)/t19-,20-,29?/m0/s1 |
| InChIKey | KVBXNGXMFLEEFI-OCGDJMBTSA-N |
| XLogP | 5.61 |
| TPSA | 137.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.63 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|