C31H40N2O9P2 — CID 87966465
5-[2,2-bis(4,5-dimethyl-2-oxo-1,3,2λ5-dioxaphospholan-2-yl)ethyl]-2-methoxy-N-methyl-N-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethyl]benzamide (PubChem CID 87966465) has the molecular formula C31H40N2O9P2 and a molecular weight of 646.61 g/mol. Its IUPAC name is 5-[2,2-bis(4,5-dimethyl-2-oxo-1,3,2λ5-dioxaphospholan-2-yl)ethyl]-2-methoxy-N-methyl-N-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethyl]benzamide.
| Compound Name | 5-[2,2-bis(4,5-dimethyl-2-oxo-1,3,2λ5-dioxaphospholan-2-yl)ethyl]-2-methoxy-N-methyl-N-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 87966465 |
| Molecular Formula | C31H40N2O9P2 |
| Molecular Weight | 646.61 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | 5-[2,2-bis(4,5-dimethyl-2-oxo-1,3,2λ5-dioxaphospholan-2-yl)ethyl]-2-methoxy-N-methyl-N-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethyl]benzamide |
| SMILES | COc1ccc(CC(P2(=O)OC(C)C(C)O2)P2(=O)OC(C)C(C)O2)cc1C(=O)N(C)CCc1nc(-c2ccccc2)oc1C |
| InChI | InChI=1S/C31H40N2O9P2/c1-19-20(2)40-43(35,39-19)29(44(36)41-21(3)22(4)42-44)18-24-13-14-28(37-7)26(17-24)31(34)33(6)16-15-27-23(5)38-30(32-27)25-11-9-8-10-12-25/h8-14,17,19-22,29H,15-16,18H2,1-7H3 |
| InChIKey | NECBYBUPSWVERM-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 126.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.61 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|