C26H20F3NO7S — CID 87964996
(2,6-diacetylphenyl) 10-methyl-1-(trifluoromethylsulfonyloxy)-9H-acridine-9-carboxylate (PubChem CID 87964996) has the molecular formula C26H20F3NO7S and a molecular weight of 547.51 g/mol. Its IUPAC name is (2,6-diacetylphenyl) 10-methyl-1-(trifluoromethylsulfonyloxy)-9H-acridine-9-carboxylate.
| Compound Name | (2,6-diacetylphenyl) 10-methyl-1-(trifluoromethylsulfonyloxy)-9H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 87964996 |
| Molecular Formula | C26H20F3NO7S |
| Molecular Weight | 547.51 g/mol |
| Exact Mass | 547.09 |
| IUPAC Name | (2,6-diacetylphenyl) 10-methyl-1-(trifluoromethylsulfonyloxy)-9H-acridine-9-carboxylate |
| SMILES | CC(=O)c1cccc(C(C)=O)c1OC(=O)C1c2ccccc2N(C)c2cccc(OS(=O)(=O)C(F)(F)F)c21 |
| InChI | InChI=1S/C26H20F3NO7S/c1-14(31)16-9-6-10-17(15(2)32)24(16)36-25(33)22-18-8-4-5-11-19(18)30(3)20-12-7-13-21(23(20)22)37-38(34,35)26(27,28)29/h4-13,22H,1-3H3 |
| InChIKey | HGNWHHXTUUMBEE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|