C26H30F3NO3 — CID 87965798
2-[1-(2-methoxyphenyl)cyclobutyl]-2-[3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-1-yl]acetaldehyde (PubChem CID 87965798) has the molecular formula C26H30F3NO3 and a molecular weight of 461.52 g/mol. Its IUPAC name is 2-[1-(2-methoxyphenyl)cyclobutyl]-2-[3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-1-yl]acetaldehyde.
| Compound Name | 2-[1-(2-methoxyphenyl)cyclobutyl]-2-[3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 87965798 |
| Molecular Formula | C26H30F3NO3 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 2-[1-(2-methoxyphenyl)cyclobutyl]-2-[3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-1-yl]acetaldehyde |
| SMILES | COc1ccccc1C1(C(C=O)N2CCCC(COc3ccc(C(F)(F)F)cc3)C2)CCC1 |
| InChI | InChI=1S/C26H30F3NO3/c1-32-23-8-3-2-7-22(23)25(13-5-14-25)24(17-31)30-15-4-6-19(16-30)18-33-21-11-9-20(10-12-21)26(27,28)29/h2-3,7-12,17,19,24H,4-6,13-16,18H2,1H3 |
| InChIKey | PDNBEYRZLQWLNT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|