C25H27ClF3NO2 — CID 87988857
2-(4-chlorophenyl)-2-cyclobutyl-2-[3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-1-yl]acetaldehyde (PubChem CID 87988857) has the molecular formula C25H27ClF3NO2 and a molecular weight of 465.94 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-cyclobutyl-2-[3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-1-yl]acetaldehyde.
| Compound Name | 2-(4-chlorophenyl)-2-cyclobutyl-2-[3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 87988857 |
| Molecular Formula | C25H27ClF3NO2 |
| Molecular Weight | 465.94 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 2-(4-chlorophenyl)-2-cyclobutyl-2-[3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-1-yl]acetaldehyde |
| SMILES | O=CC(c1ccc(Cl)cc1)(C1CCC1)N1CCCC(COc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C25H27ClF3NO2/c26-22-10-6-20(7-11-22)24(17-31,19-4-1-5-19)30-14-2-3-18(15-30)16-32-23-12-8-21(9-13-23)25(27,28)29/h6-13,17-19H,1-5,14-16H2 |
| InChIKey | SCIXVAYRBIGSNR-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.94 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|