C28H34F3NO2 — CID 143089642
acetylene;(3S)-1-[2-[1-(2-methoxyphenyl)cyclobutyl]ethyl]-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidine (PubChem CID 143089642) has the molecular formula C28H34F3NO2 and a molecular weight of 473.58 g/mol. Its IUPAC name is acetylene;(3S)-1-[2-[1-(2-methoxyphenyl)cyclobutyl]ethyl]-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidine.
| Compound Name | acetylene;(3S)-1-[2-[1-(2-methoxyphenyl)cyclobutyl]ethyl]-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidine |
|---|---|
| PubChem CID | 143089642 |
| Molecular Formula | C28H34F3NO2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | acetylene;(3S)-1-[2-[1-(2-methoxyphenyl)cyclobutyl]ethyl]-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidine |
| SMILES | C#C.COc1ccccc1C1(CCN2CCC[C@H](COc3ccc(C(F)(F)F)cc3)C2)CCC1 |
| InChI | InChI=1S/C26H32F3NO2.C2H2/c1-31-24-8-3-2-7-23(24)25(13-5-14-25)15-17-30-16-4-6-20(18-30)19-32-22-11-9-21(10-12-22)26(27,28)29;1-2/h2-3,7-12,20H,4-6,13-19H2,1H3;1-2H/t20-;/m0./s1 |
| InChIKey | HWJJCIRGIFNTJE-BDQAORGHSA-N |
| XLogP | 6.57 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|