C13H22O3S — CID 87966025
[1,2-bis(prop-2-enyl)cyclohexyl] methanesulfonate (PubChem CID 87966025) has the molecular formula C13H22O3S and a molecular weight of 258.38 g/mol. Its IUPAC name is [1,2-bis(prop-2-enyl)cyclohexyl] methanesulfonate.
| Compound Name | [1,2-bis(prop-2-enyl)cyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 87966025 |
| Molecular Formula | C13H22O3S |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | [1,2-bis(prop-2-enyl)cyclohexyl] methanesulfonate |
| SMILES | C=CCC1CCCCC1(CC=C)OS(C)(=O)=O |
| InChI | InChI=1S/C13H22O3S/c1-4-8-12-9-6-7-11-13(12,10-5-2)16-17(3,14)15/h4-5,12H,1-2,6-11H2,3H3 |
| InChIKey | YBQRSDUSZUPSJQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|