About [1,2-bis(prop-2-enyl)cyclohexyl] methanesulfonate
[1,2-bis(prop-2-enyl)cyclohexyl] methanesulfonate (PubChem CID 87966025) has the molecular formula C13H22O3S
and a molecular weight of 258.38 g/mol. Its IUPAC name is [1,2-bis(prop-2-enyl)cyclohexyl] methanesulfonate.
Molecular Properties
| Compound Name | [1,2-bis(prop-2-enyl)cyclohexyl] methanesulfonate |
| PubChem CID | 87966025 |
| Molecular Formula | C13H22O3S |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | [1,2-bis(prop-2-enyl)cyclohexyl] methanesulfonate |
| SMILES | C=CCC1CCCCC1(CC=C)OS(C)(=O)=O |
| InChI | InChI=1S/C13H22O3S/c1-4-8-12-9-6-7-11-13(12,10-5-2)16-17(3,14)15/h4-5,12H,1-2,6-11H2,3H3 |
| InChIKey | YBQRSDUSZUPSJQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [1,2-bis(prop-2-enyl)cyclohexyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2-bis(prop-2-enyl)cyclohexyl] methanesulfonate?
The IUPAC name of [1,2-bis(prop-2-enyl)cyclohexyl] methanesulfonate (CID 87966025) is [1,2-bis(prop-2-enyl)cyclohexyl] methanesulfonate.
What is the SMILES notation for [1,2-bis(prop-2-enyl)cyclohexyl] methanesulfonate?
The canonical SMILES for [1,2-bis(prop-2-enyl)cyclohexyl] methanesulfonate is C=CCC1CCCCC1(CC=C)OS(C)(=O)=O.
What is the InChIKey of [1,2-bis(prop-2-enyl)cyclohexyl] methanesulfonate?
The InChIKey is YBQRSDUSZUPSJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O3S/c1-4-8-12-9-6-7-11-13(12,10-5-2)16-17(3,14)15/h4-5,12H,1-2,6-11H2,3H3.
What are the key properties of [1,2-bis(prop-2-enyl)cyclohexyl] methanesulfonate?
[1,2-bis(prop-2-enyl)cyclohexyl] methanesulfonate has a molecular weight of 258.38 g/mol, XLogP of 3.04, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2-bis(prop-2-enyl)cyclohexyl] methanesulfonate is sourced from PubChem (CID 87966025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).