C31H33BrN3O10S2- — CID 87968072
methyl 2-[5-[[2-(benzenesulfonamido)-3-[3-bromo-4-(2,2-dioxido-3-oxo-1,2-thiazolidin-2-ium-5-yl)phenyl]propanoyl]amino]pentoxy]-6-hydroxybenzoate (PubChem CID 87968072) has the molecular formula C31H33BrN3O10S2- and a molecular weight of 751.65 g/mol. Its IUPAC name is methyl 2-[5-[[2-(benzenesulfonamido)-3-[3-bromo-4-(2,2-dioxido-3-oxo-1,2-thiazolidin-2-ium-5-yl)phenyl]propanoyl]amino]pentoxy]-6-hydroxybenzoate.
| Compound Name | methyl 2-[5-[[2-(benzenesulfonamido)-3-[3-bromo-4-(2,2-dioxido-3-oxo-1,2-thiazolidin-2-ium-5-yl)phenyl]propanoyl]amino]pentoxy]-6-hydroxybenzoate |
|---|---|
| PubChem CID | 87968072 |
| Molecular Formula | C31H33BrN3O10S2- |
| Molecular Weight | 751.65 g/mol |
| Exact Mass | 750.08 |
| IUPAC Name | methyl 2-[5-[[2-(benzenesulfonamido)-3-[3-bromo-4-(2,2-dioxido-3-oxo-1,2-thiazolidin-2-ium-5-yl)phenyl]propanoyl]amino]pentoxy]-6-hydroxybenzoate |
| SMILES | COC(=O)c1c(O)cccc1OCCCCCNC(=O)C(Cc1ccc(C2CC(=O)[N+]([O-])([O-])S2)c(Br)c1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H33BrN3O10S2/c1-44-31(39)29-25(36)11-8-12-26(29)45-16-7-3-6-15-33-30(38)24(34-47(42,43)21-9-4-2-5-10-21)18-20-13-14-22(23(32)17-20)27-19-28(37)35(40,41)46-27/h2,4-5,8-14,17,24,27,34,36H,3,6-7,15-16,18-19H2,1H3,(H,33,38)/q-1 |
| InChIKey | WDBVMYSYGHDGAN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 194.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.65 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|