C19H23F3N2 — CID 87973113
N',N'-dimethyl-N-[[4-(2,3,5-trifluoro-4-methylphenyl)phenyl]methyl]propane-1,3-diamine (PubChem CID 87973113) has the molecular formula C19H23F3N2 and a molecular weight of 336.40 g/mol. Its IUPAC name is N',N'-dimethyl-N-[[4-(2,3,5-trifluoro-4-methylphenyl)phenyl]methyl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[[4-(2,3,5-trifluoro-4-methylphenyl)phenyl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 87973113 |
| Molecular Formula | C19H23F3N2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N',N'-dimethyl-N-[[4-(2,3,5-trifluoro-4-methylphenyl)phenyl]methyl]propane-1,3-diamine |
| SMILES | Cc1c(F)cc(-c2ccc(CNCCCN(C)C)cc2)c(F)c1F |
| InChI | InChI=1S/C19H23F3N2/c1-13-17(20)11-16(19(22)18(13)21)15-7-5-14(6-8-15)12-23-9-4-10-24(2)3/h5-8,11,23H,4,9-10,12H2,1-3H3 |
| InChIKey | RDXLLQGJLXWZQH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|