C10H17F3O5 — CID 87974815
1-(1-ethoxyethoxy)ethyl 4,4,4-trifluoro-3-hydroxybutanoate (PubChem CID 87974815) has the molecular formula C10H17F3O5 and a molecular weight of 274.24 g/mol. Its IUPAC name is 1-(1-ethoxyethoxy)ethyl 4,4,4-trifluoro-3-hydroxybutanoate.
| Compound Name | 1-(1-ethoxyethoxy)ethyl 4,4,4-trifluoro-3-hydroxybutanoate |
|---|---|
| PubChem CID | 87974815 |
| Molecular Formula | C10H17F3O5 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-(1-ethoxyethoxy)ethyl 4,4,4-trifluoro-3-hydroxybutanoate |
| SMILES | CCOC(C)OC(C)OC(=O)CC(O)C(F)(F)F |
| InChI | InChI=1S/C10H17F3O5/c1-4-16-6(2)17-7(3)18-9(15)5-8(14)10(11,12)13/h6-8,14H,4-5H2,1-3H3 |
| InChIKey | FRMSNIJSHYCZQM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|